C16H17F3N2O4 — CID 8940535
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate (PubChem CID 8940535) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 8940535 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] (2S)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)/C=C/c1ccccc1)C(=O)OCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O4/c1-11(15(24)25-9-14(23)20-10-16(17,18)19)21-13(22)8-7-12-5-3-2-4-6-12/h2-8,11H,9-10H2,1H3,(H,20,23)(H,21,22)/b8-7+/t11-/m0/s1 |
| InChIKey | NORDDHPCYJQILC-AEZGRPFRSA-N |
| XLogP | 1.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|