C25H30N2O6S — CID 3933869
[2-(4-ethoxyanilino)-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate (PubChem CID 3933869) has the molecular formula C25H30N2O6S and a molecular weight of 486.59 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3933869 |
| Molecular Formula | C25H30N2O6S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]prop-2-enoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)C=Cc2ccc(S(=O)(=O)N3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H30N2O6S/c1-2-32-22-12-10-21(11-13-22)26-24(28)19-33-25(29)16-9-20-7-14-23(15-8-20)34(30,31)27-17-5-3-4-6-18-27/h7-16H,2-6,17-19H2,1H3,(H,26,28) |
| InChIKey | DRLNUMFDMGWVIP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|