C21H21N3O8S — CID 42005812
[2-(4-nitroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 42005812) has the molecular formula C21H21N3O8S and a molecular weight of 475.48 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42005812 |
| Molecular Formula | C21H21N3O8S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N3O8S/c25-20(22-17-4-6-18(7-5-17)24(27)28)15-32-21(26)10-3-16-1-8-19(9-2-16)33(29,30)23-11-13-31-14-12-23/h1-10H,11-15H2,(H,22,25)/b10-3+ |
| InChIKey | OWYQHUBIWBLEPE-XCVCLJGOSA-N |
| XLogP | 1.81 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|