C16H19N3O7S — CID 4998576
[2-(carbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 4998576) has the molecular formula C16H19N3O7S and a molecular weight of 397.41 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4998576 |
| Molecular Formula | C16H19N3O7S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | NC(=O)NC(=O)COC(=O)C=Cc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H19N3O7S/c17-16(22)18-14(20)11-26-15(21)6-3-12-1-4-13(5-2-12)27(23,24)19-7-9-25-10-8-19/h1-6H,7-11H2,(H3,17,18,20,22) |
| InChIKey | WLVLNGNNIMEHBO-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|