C20H19Cl2N3O6S — CID 2434079
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 2434079) has the molecular formula C20H19Cl2N3O6S and a molecular weight of 500.36 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2434079 |
| Molecular Formula | C20H19Cl2N3O6S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (E)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N3O6S/c21-15-11-17(22)20(23-12-15)24-18(26)13-31-19(27)6-3-14-1-4-16(5-2-14)32(28,29)25-7-9-30-10-8-25/h1-6,11-12H,7-10,13H2,(H,23,24,26)/b6-3+ |
| InChIKey | MDSHNGULELWHSC-ZZXKWVIFSA-N |
| XLogP | 2.60 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|