C18H18ClN3O6S — CID 16527536
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 16527536) has the molecular formula C18H18ClN3O6S and a molecular weight of 439.88 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16527536 |
| Molecular Formula | C18H18ClN3O6S |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C18H18ClN3O6S/c19-14-3-6-16(20-11-14)21-17(23)12-28-18(24)13-1-4-15(5-2-13)29(25,26)22-7-9-27-10-8-22/h1-6,11H,7-10,12H2,(H,20,21,23) |
| InChIKey | BKAAUGNFHSKWNF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |