C27H29N3O5 — CID 42971257
2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 42971257) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 42971257 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[(E)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1cc(/C=N/OCC(=O)Nc2ccc(N3CCOCC3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H29N3O5/c1-32-26-17-22(7-12-25(26)34-19-21-5-3-2-4-6-21)18-28-35-20-27(31)29-23-8-10-24(11-9-23)30-13-15-33-16-14-30/h2-12,17-18H,13-16,19-20H2,1H3,(H,29,31)/b28-18+ |
| InChIKey | MKLQSBUNJXYLNI-MTDXEUNCSA-N |
| XLogP | 4.10 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|