C22H26N2O4 — CID 7669475
2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-1-piperidin-1-ylethanone (PubChem CID 7669475) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-1-piperidin-1-ylethanone.
| Compound Name | 2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 7669475 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]oxy-1-piperidin-1-ylethanone |
| SMILES | COc1cc(/C=N\OCC(=O)N2CCCCC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-26-21-14-19(10-11-20(21)27-16-18-8-4-2-5-9-18)15-23-28-17-22(25)24-12-6-3-7-13-24/h2,4-5,8-11,14-15H,3,6-7,12-13,16-17H2,1H3/b23-15- |
| InChIKey | UBSKWHFWQXVYBF-HAHDFKILSA-N |
| XLogP | 3.64 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|