C17H23ClN2O4 — CID 7702672
1-(azepan-1-yl)-2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyethanone (PubChem CID 7702672) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyethanone |
|---|---|
| PubChem CID | 7702672 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyethanone |
| SMILES | COc1cc(/C=N\OCC(=O)N2CCCCCC2)cc(Cl)c1OC |
| InChI | InChI=1S/C17H23ClN2O4/c1-22-15-10-13(9-14(18)17(15)23-2)11-19-24-12-16(21)20-7-5-3-4-6-8-20/h9-11H,3-8,12H2,1-2H3/b19-11- |
| InChIKey | MSEUMSMVFOBQAK-ODLFYWEKSA-N |
| XLogP | 3.11 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|