C15H16ClN3O5 — CID 7702948
2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(5-methyl-1,2-oxazol-3-yl)acetamide (PubChem CID 7702948) has the molecular formula C15H16ClN3O5 and a molecular weight of 353.76 g/mol. Its IUPAC name is 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(5-methyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 7702948 |
| Molecular Formula | C15H16ClN3O5 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| SMILES | COc1cc(/C=N\OCC(=O)Nc2cc(C)on2)cc(Cl)c1OC |
| InChI | InChI=1S/C15H16ClN3O5/c1-9-4-13(19-24-9)18-14(20)8-23-17-7-10-5-11(16)15(22-3)12(6-10)21-2/h4-7H,8H2,1-3H3,(H,18,19,20)/b17-7- |
| InChIKey | YVQMUXQXSKQEKQ-IDUWFGFVSA-N |
| XLogP | 2.64 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|