C11H12ClNO5 — CID 77013358
2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetic acid (PubChem CID 77013358) has the molecular formula C11H12ClNO5 and a molecular weight of 273.67 g/mol. Its IUPAC name is 2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetic acid.
| Compound Name | 2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 77013358 |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetic acid |
| SMILES | COc1cc(C=NOCC(=O)O)cc(Cl)c1OC |
| InChI | InChI=1S/C11H12ClNO5/c1-16-9-4-7(3-8(12)11(9)17-2)5-13-18-6-10(14)15/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | MAMWVACRPWWSOH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|