C16H15Cl2NO3 — CID 7702644
(Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[(4-chlorophenyl)methoxy]methanimine (PubChem CID 7702644) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is (Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[(4-chlorophenyl)methoxy]methanimine.
| Compound Name | (Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[(4-chlorophenyl)methoxy]methanimine |
|---|---|
| PubChem CID | 7702644 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[(4-chlorophenyl)methoxy]methanimine |
| SMILES | COc1cc(/C=N\OCc2ccc(Cl)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C16H15Cl2NO3/c1-20-15-8-12(7-14(18)16(15)21-2)9-19-22-10-11-3-5-13(17)6-4-11/h3-9H,10H2,1-2H3/b19-9- |
| InChIKey | ZMDGFLJNBFKQDL-OCKHKDLRSA-N |
| XLogP | 4.56 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|