C19H18ClN3O4 — CID 7703084
(Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine (PubChem CID 7703084) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is (Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine.
| Compound Name | (Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 7703084 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (Z)-1-(3-chloro-4,5-dimethoxyphenyl)-N-[[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine |
| SMILES | COc1cc(/C=N\OCc2nc(-c3ccccc3C)no2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H18ClN3O4/c1-12-6-4-5-7-14(12)19-22-17(27-23-19)11-26-21-10-13-8-15(20)18(25-3)16(9-13)24-2/h4-10H,11H2,1-3H3/b21-10- |
| InChIKey | IIHQNWPJBGSQCE-FBHDLOMBSA-N |
| XLogP | 4.27 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|