C18H16ClN3O4 — CID 9353919
(Z)-1-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine (PubChem CID 9353919) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine.
| Compound Name | (Z)-1-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 9353919 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methoxy]methanimine |
| SMILES | COc1ccc(-c2noc(CO/N=C\c3ccc(Cl)cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C18H16ClN3O4/c1-23-14-7-8-15(16(9-14)24-2)18-21-17(26-22-18)11-25-20-10-12-3-5-13(19)6-4-12/h3-10H,11H2,1-2H3/b20-10- |
| InChIKey | OYMPUVKPBYCJRH-JMIUGGIZSA-N |
| XLogP | 3.96 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|