C21H20ClN3O4 — CID 99998559
(E)-3-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide (PubChem CID 99998559) has the molecular formula C21H20ClN3O4 and a molecular weight of 413.86 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 99998559 |
| Molecular Formula | C21H20ClN3O4 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide |
| SMILES | COc1ccc(-c2noc(CN(C)C(=O)/C=C/c3ccc(Cl)cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C21H20ClN3O4/c1-25(20(26)11-6-14-4-7-15(22)8-5-14)13-19-23-21(24-29-19)17-10-9-16(27-2)12-18(17)28-3/h4-12H,13H2,1-3H3/b11-6+ |
| InChIKey | BDEQFGAAFYWRSN-IZZDOVSWSA-N |
| XLogP | 4.08 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|