C20H16ClN3O4 — CID 99997340
(E)-3-(1,3-benzodioxol-5-yl)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide (PubChem CID 99997340) has the molecular formula C20H16ClN3O4 and a molecular weight of 397.82 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 99997340 |
| Molecular Formula | C20H16ClN3O4 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide |
| SMILES | CN(Cc1nc(-c2ccccc2Cl)no1)C(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H16ClN3O4/c1-24(11-18-22-20(23-28-18)14-4-2-3-5-15(14)21)19(25)9-7-13-6-8-16-17(10-13)27-12-26-16/h2-10H,11-12H2,1H3/b9-7+ |
| InChIKey | BQZHGXDOUFLIHX-VQHVLOKHSA-N |
| XLogP | 3.79 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|