C19H15BrClN3O2 — CID 99998569
(E)-N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide (PubChem CID 99998569) has the molecular formula C19H15BrClN3O2 and a molecular weight of 432.71 g/mol. Its IUPAC name is (E)-N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 99998569 |
| Molecular Formula | C19H15BrClN3O2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | (E)-N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-chlorophenyl)-N-methylprop-2-enamide |
| SMILES | CN(Cc1nc(-c2cccc(Br)c2)no1)C(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15BrClN3O2/c1-24(18(25)10-7-13-5-8-16(21)9-6-13)12-17-22-19(23-26-17)14-3-2-4-15(20)11-14/h2-11H,12H2,1H3/b10-7+ |
| InChIKey | XTCWMWKOKNCFLK-JXMROGBWSA-N |
| XLogP | 4.82 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|