C17H14FN3O2S — CID 99996592
(E)-3-(4-fluorophenyl)-N-methyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide (PubChem CID 99996592) has the molecular formula C17H14FN3O2S and a molecular weight of 343.38 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-methyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-methyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 99996592 |
| Molecular Formula | C17H14FN3O2S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-methyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
| SMILES | CN(Cc1nc(-c2cccs2)no1)C(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14FN3O2S/c1-21(16(22)9-6-12-4-7-13(18)8-5-12)11-15-19-17(20-23-15)14-3-2-10-24-14/h2-10H,11H2,1H3/b9-6+ |
| InChIKey | IMWKQVJCWVCAGK-RMKNXTFCSA-N |
| XLogP | 3.61 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|