C18H15F4NO — CID 134047167
(E)-3-(4-fluorophenyl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 134047167) has the molecular formula C18H15F4NO and a molecular weight of 337.32 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134047167 |
| Molecular Formula | C18H15F4NO |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CN(Cc1ccccc1C(F)(F)F)C(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15F4NO/c1-23(12-14-4-2-3-5-16(14)18(20,21)22)17(24)11-8-13-6-9-15(19)10-7-13/h2-11H,12H2,1H3/b11-8+ |
| InChIKey | VIBKVROCQCFHRL-DHZHZOJOSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|