C19H15ClF3NO3 — CID 134047226
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 134047226) has the molecular formula C19H15ClF3NO3 and a molecular weight of 397.78 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134047226 |
| Molecular Formula | C19H15ClF3NO3 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | CN(Cc1ccccc1C(F)(F)F)C(=O)/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H15ClF3NO3/c1-24(10-13-4-2-3-5-14(13)19(21,22)23)17(25)7-6-12-8-15(20)18-16(9-12)26-11-27-18/h2-9H,10-11H2,1H3/b7-6+ |
| InChIKey | RCUUXFTUWXGFIL-VOTSOKGWSA-N |
| XLogP | 4.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|