C19H17ClFNO3 — CID 75405145
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide (PubChem CID 75405145) has the molecular formula C19H17ClFNO3 and a molecular weight of 361.80 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 75405145 |
| Molecular Formula | C19H17ClFNO3 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]-N-methylprop-2-enamide |
| SMILES | CN(CCc1ccc(F)cc1)C(=O)/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H17ClFNO3/c1-22(9-8-13-2-5-15(21)6-3-13)18(23)7-4-14-10-16(20)19-17(11-14)24-12-25-19/h2-7,10-11H,8-9,12H2,1H3/b7-4+ |
| InChIKey | KWDBNDANGUXITJ-QPJJXVBHSA-N |
| XLogP | 3.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|