C15H16ClNO5 — CID 8836037
[(2R)-1-(dimethylamino)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8836037) has the molecular formula C15H16ClNO5 and a molecular weight of 325.75 g/mol. Its IUPAC name is [(2R)-1-(dimethylamino)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(dimethylamino)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8836037 |
| Molecular Formula | C15H16ClNO5 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [(2R)-1-(dimethylamino)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)C(=O)N(C)C |
| InChI | InChI=1S/C15H16ClNO5/c1-9(15(19)17(2)3)22-13(18)5-4-10-6-11(16)14-12(7-10)20-8-21-14/h4-7,9H,8H2,1-3H3/b5-4+/t9-/m1/s1 |
| InChIKey | JMRFLXAXULAHSO-XNPJLODASA-N |
| XLogP | 2.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|