C20H17ClN2O6 — CID 9063217
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 9063217) has the molecular formula C20H17ClN2O6 and a molecular weight of 416.82 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9063217 |
| Molecular Formula | C20H17ClN2O6 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN2O6/c1-12(19(25)22-23-20(26)14-5-3-2-4-6-14)29-17(24)8-7-13-9-15(21)18-16(10-13)27-11-28-18/h2-10,12H,11H2,1H3,(H,22,25)(H,23,26)/b8-7+/t12-/m1/s1 |
| InChIKey | YRAQNSYMISDGSO-ABZNLYFFSA-N |
| XLogP | 2.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|