C18H15ClN2O6 — CID 9060769
[(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 7-chloro-1,3-benzodioxole-5-carboxylate (PubChem CID 9060769) has the molecular formula C18H15ClN2O6 and a molecular weight of 390.78 g/mol. Its IUPAC name is [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 7-chloro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 7-chloro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 9060769 |
| Molecular Formula | C18H15ClN2O6 |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 7-chloro-1,3-benzodioxole-5-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)c2c(c1)OCO2)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15ClN2O6/c1-10(16(22)20-21-17(23)11-5-3-2-4-6-11)27-18(24)12-7-13(19)15-14(8-12)25-9-26-15/h2-8,10H,9H2,1H3,(H,20,22)(H,21,23)/t10-/m0/s1 |
| InChIKey | LACMGDSEMUCOOL-JTQLQIEISA-N |
| XLogP | 2.08 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|