C19H20N2O4 — CID 8872704
[(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3,5-dimethylbenzoate (PubChem CID 8872704) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3,5-dimethylbenzoate.
| Compound Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 8872704 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)O[C@@H](C)C(=O)NNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-12-9-13(2)11-16(10-12)19(24)25-14(3)17(22)20-21-18(23)15-7-5-4-6-8-15/h4-11,14H,1-3H3,(H,20,22)(H,21,23)/t14-/m0/s1 |
| InChIKey | BVSNCAVWXHYBHX-AWEZNQCLSA-N |
| XLogP | 2.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|