C16H16N2O4S — CID 8863407
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate (PubChem CID 8863407) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 8863407 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)O[C@H](C)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-10-8-9-23-13(10)16(21)22-11(2)14(19)17-18-15(20)12-6-4-3-5-7-12/h3-9,11H,1-2H3,(H,17,19)(H,18,20)/t11-/m1/s1 |
| InChIKey | UTDCKJYLXXCWBJ-LLVKDONJSA-N |
| XLogP | 2.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|