C17H18N2O4S — CID 2086652
[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate (PubChem CID 2086652) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate.
| Compound Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2086652 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 3-methylthiophene-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)OC(=O)c2sccc2C)cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-10-8-9-24-15(10)17(22)23-11(2)16(21)19-14-6-4-13(5-7-14)18-12(3)20/h4-9,11H,1-3H3,(H,18,20)(H,19,21)/t11-/m1/s1 |
| InChIKey | WQMLVUICBVDBHV-LLVKDONJSA-N |
| XLogP | 3.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |