C20H16FNO3S — CID 7504677
[(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate (PubChem CID 7504677) has the molecular formula C20H16FNO3S and a molecular weight of 369.42 g/mol. Its IUPAC name is [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7504677 |
| Molecular Formula | C20H16FNO3S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)O[C@@H](C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H16FNO3S/c1-13-11-12-26-18(13)20(24)25-17(14-5-3-2-4-6-14)19(23)22-16-9-7-15(21)8-10-16/h2-12,17H,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | CBIIOGNSQQEZIO-QGZVFWFLSA-N |
| XLogP | 4.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |