C21H16FNO4 — CID 2646591
[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-hydroxybenzoate (PubChem CID 2646591) has the molecular formula C21H16FNO4 and a molecular weight of 365.36 g/mol. Its IUPAC name is [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-hydroxybenzoate.
| Compound Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 2646591 |
| Molecular Formula | C21H16FNO4 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-hydroxybenzoate |
| SMILES | O=C(O[C@H](C(=O)Nc1ccc(F)cc1)c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C21H16FNO4/c22-15-10-12-16(13-11-15)23-20(25)19(14-6-2-1-3-7-14)27-21(26)17-8-4-5-9-18(17)24/h1-13,19,24H,(H,23,25)/t19-/m0/s1 |
| InChIKey | URTQTXUDAJVEBW-IBGZPJMESA-N |
| XLogP | 4.07 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |