C23H20FNO5S — CID 16518158
[2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 16518158) has the molecular formula C23H20FNO5S and a molecular weight of 441.48 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 16518158 |
| Molecular Formula | C23H20FNO5S |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OC(C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H20FNO5S/c1-15-8-13-19(31(2,28)29)14-20(15)23(27)30-21(16-6-4-3-5-7-16)22(26)25-18-11-9-17(24)10-12-18/h3-14,21H,1-2H3,(H,25,26) |
| InChIKey | CWLDLYPVPDHHAG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |