C17H17FO4S — CID 29435492
[(1S)-1-(4-fluorophenyl)ethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 29435492) has the molecular formula C17H17FO4S and a molecular weight of 336.38 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)ethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [(1S)-1-(4-fluorophenyl)ethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 29435492 |
| Molecular Formula | C17H17FO4S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)ethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)O[C@@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FO4S/c1-11-4-9-15(23(3,20)21)10-16(11)17(19)22-12(2)13-5-7-14(18)8-6-13/h4-10,12H,1-3H3/t12-/m0/s1 |
| InChIKey | CPPSJFXXETYOAQ-LBPRGKRZSA-N |
| XLogP | 3.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |