C18H16F3NO5S — CID 7849601
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 7849601) has the molecular formula C18H16F3NO5S and a molecular weight of 415.39 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7849601 |
| Molecular Formula | C18H16F3NO5S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)O[C@@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3NO5S/c1-9-4-5-11(28(3,25)26)8-12(9)18(24)27-10(2)17(23)22-14-7-6-13(19)15(20)16(14)21/h4-8,10H,1-3H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | WKXZWZWBMZTMCU-JTQLQIEISA-N |
| XLogP | 3.00 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|