C20H19F3N2O5S — CID 46679283
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate (PubChem CID 46679283) has the molecular formula C20H19F3N2O5S and a molecular weight of 456.44 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 46679283 |
| Molecular Formula | C20H19F3N2O5S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 5-(cyclopropylsulfamoyl)-2-methylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC2)cc1C(=O)OC(C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H19F3N2O5S/c1-10-3-6-13(31(28,29)25-12-4-5-12)9-14(10)20(27)30-11(2)19(26)24-16-8-7-15(21)17(22)18(16)23/h3,6-9,11-12,25H,4-5H2,1-2H3,(H,24,26) |
| InChIKey | ICWRTAHDDJWXTN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|