C14H17FN2O5S — CID 18104177
[1-(cyclopropylamino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18104177) has the molecular formula C14H17FN2O5S and a molecular weight of 344.36 g/mol. Its IUPAC name is [1-(cyclopropylamino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18104177 |
| Molecular Formula | C14H17FN2O5S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [1-(cyclopropylamino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OC(C)C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C14H17FN2O5S/c1-8(13(18)17-9-3-4-9)22-14(19)11-7-10(5-6-12(11)15)23(20,21)16-2/h5-9,16H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | YAYUVEBQRRHNIQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |