C18H19FN2O5S — CID 18104176
[1-(3-methylanilino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18104176) has the molecular formula C18H19FN2O5S and a molecular weight of 394.42 g/mol. Its IUPAC name is [1-(3-methylanilino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18104176 |
| Molecular Formula | C18H19FN2O5S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [1-(3-methylanilino)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OC(C)C(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C18H19FN2O5S/c1-11-5-4-6-13(9-11)21-17(22)12(2)26-18(23)15-10-14(7-8-16(15)19)27(24,25)20-3/h4-10,12,20H,1-3H3,(H,21,22) |
| InChIKey | CILRDGORDHCWNK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |