C18H18FNO6S — CID 18104179
[1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18104179) has the molecular formula C18H18FNO6S and a molecular weight of 395.41 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18104179 |
| Molecular Formula | C18H18FNO6S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OC(C)C(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C18H18FNO6S/c1-11(17(21)12-4-6-13(25-3)7-5-12)26-18(22)15-10-14(8-9-16(15)19)27(23,24)20-2/h4-11,20H,1-3H3 |
| InChIKey | LNYNOQKHUDTHIJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |