C17H17FN2O6S — CID 18085306
[2-(4-methoxyanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18085306) has the molecular formula C17H17FN2O6S and a molecular weight of 396.40 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18085306 |
| Molecular Formula | C17H17FN2O6S |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)Nc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C17H17FN2O6S/c1-19-27(23,24)13-7-8-15(18)14(9-13)17(22)26-10-16(21)20-11-3-5-12(25-2)6-4-11/h3-9,19H,10H2,1-2H3,(H,20,21) |
| InChIKey | HZTZZFWQWZSIGE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |