C15H21FN2O5S — CID 34876926
[2-oxo-2-(pentylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 34876926) has the molecular formula C15H21FN2O5S and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-oxo-2-(pentylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(pentylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 34876926 |
| Molecular Formula | C15H21FN2O5S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [2-oxo-2-(pentylamino)ethyl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CCCCCNC(=O)COC(=O)c1cc(S(=O)(=O)NC)ccc1F |
| InChI | InChI=1S/C15H21FN2O5S/c1-3-4-5-8-18-14(19)10-23-15(20)12-9-11(6-7-13(12)16)24(21,22)17-2/h6-7,9,17H,3-5,8,10H2,1-2H3,(H,18,19) |
| InChIKey | NOJYJXUTXLAKBI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|