C12H16FNO4S — CID 18169512
butyl 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18169512) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is butyl 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | butyl 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18169512 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | butyl 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CCCCOC(=O)c1cc(S(=O)(=O)NC)ccc1F |
| InChI | InChI=1S/C12H16FNO4S/c1-3-4-7-18-12(15)10-8-9(5-6-11(10)13)19(16,17)14-2/h5-6,8,14H,3-4,7H2,1-2H3 |
| InChIKey | PDFDIYBAHONBHJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|