C17H17ClFNO5S — CID 43056408
3-(4-fluorophenoxy)propyl 2-chloro-5-(methylsulfamoyl)benzoate (PubChem CID 43056408) has the molecular formula C17H17ClFNO5S and a molecular weight of 401.84 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)propyl 2-chloro-5-(methylsulfamoyl)benzoate.
| Compound Name | 3-(4-fluorophenoxy)propyl 2-chloro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 43056408 |
| Molecular Formula | C17H17ClFNO5S |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 3-(4-fluorophenoxy)propyl 2-chloro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)OCCCOc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H17ClFNO5S/c1-20-26(22,23)14-7-8-16(18)15(11-14)17(21)25-10-2-9-24-13-5-3-12(19)4-6-13/h3-8,11,20H,2,9-10H2,1H3 |
| InChIKey | WCJVYJIWRHIUIQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|