C18H15ClF2N2O7S — CID 30327868
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-chloro-5-(methylsulfamoyl)benzoate (PubChem CID 30327868) has the molecular formula C18H15ClF2N2O7S and a molecular weight of 476.84 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-chloro-5-(methylsulfamoyl)benzoate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-chloro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30327868 |
| Molecular Formula | C18H15ClF2N2O7S |
| Molecular Weight | 476.84 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-chloro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)NC(=O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C18H15ClF2N2O7S/c1-22-31(27,28)12-6-7-14(19)13(8-12)17(26)29-9-15(24)23-16(25)10-2-4-11(5-3-10)30-18(20)21/h2-8,18,22H,9H2,1H3,(H,23,24,25) |
| InChIKey | MFOLAVUDDQYGBX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.84 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |