C19H12ClF2NO6 — CID 27998441
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate (PubChem CID 27998441) has the molecular formula C19H12ClF2NO6 and a molecular weight of 423.76 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 27998441 |
| Molecular Formula | C19H12ClF2NO6 |
| Molecular Weight | 423.76 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2cc(Cl)ccc2o1)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H12ClF2NO6/c20-12-3-6-14-11(7-12)8-15(29-14)18(26)27-9-16(24)23-17(25)10-1-4-13(5-2-10)28-19(21)22/h1-8,19H,9H2,(H,23,24,25) |
| InChIKey | KWFKLLIVLAWMAZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |