C20H17ClN2O7 — CID 27998412
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate (PubChem CID 27998412) has the molecular formula C20H17ClN2O7 and a molecular weight of 432.82 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 27998412 |
| Molecular Formula | C20H17ClN2O7 |
| Molecular Weight | 432.82 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)c2cc3cc(Cl)ccc3o2)cc1OC |
| InChI | InChI=1S/C20H17ClN2O7/c1-27-15-5-3-11(8-16(15)28-2)19(25)23-22-18(24)10-29-20(26)17-9-12-7-13(21)4-6-14(12)30-17/h3-9H,10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | CFHFXMZWJJAGNV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.82 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|