C18H14ClNO5 — CID 1208241
N-(6-chloro-2-oxochromen-3-yl)-3,4-dimethoxybenzamide (PubChem CID 1208241) has the molecular formula C18H14ClNO5 and a molecular weight of 359.77 g/mol. Its IUPAC name is N-(6-chloro-2-oxochromen-3-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(6-chloro-2-oxochromen-3-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 1208241 |
| Molecular Formula | C18H14ClNO5 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(6-chloro-2-oxochromen-3-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc3cc(Cl)ccc3oc2=O)cc1OC |
| InChI | InChI=1S/C18H14ClNO5/c1-23-15-5-3-10(9-16(15)24-2)17(21)20-13-8-11-7-12(19)4-6-14(11)25-18(13)22/h3-9H,1-2H3,(H,20,21) |
| InChIKey | NCVFQOFQKYRMIC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|