C21H24N2O7 — CID 29345614
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate (PubChem CID 29345614) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate |
|---|---|
| PubChem CID | 29345614 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(4-ethylphenoxy)acetate |
| SMILES | CCc1ccc(OCC(=O)OCC(=O)NNC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H24N2O7/c1-4-14-5-8-16(9-6-14)29-13-20(25)30-12-19(24)22-23-21(26)15-7-10-17(27-2)18(11-15)28-3/h5-11H,4,12-13H2,1-3H3,(H,22,24)(H,23,26) |
| InChIKey | XAMMTHPOMXQQSV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|