C25H26N2O5 — CID 4952907
N'-[2-(4-ethylphenoxy)acetyl]-4-(2-phenoxyethoxy)benzohydrazide (PubChem CID 4952907) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is N'-[2-(4-ethylphenoxy)acetyl]-4-(2-phenoxyethoxy)benzohydrazide.
| Compound Name | N'-[2-(4-ethylphenoxy)acetyl]-4-(2-phenoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 4952907 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N'-[2-(4-ethylphenoxy)acetyl]-4-(2-phenoxyethoxy)benzohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)c2ccc(OCCOc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O5/c1-2-19-8-12-23(13-9-19)32-18-24(28)26-27-25(29)20-10-14-22(15-11-20)31-17-16-30-21-6-4-3-5-7-21/h3-15H,2,16-18H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | NOYDMACAKJDYJN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|