C18H17F3N2O4 — CID 2090675
N'-[2-(4-ethylphenoxy)acetyl]-4-(trifluoromethoxy)benzohydrazide (PubChem CID 2090675) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is N'-[2-(4-ethylphenoxy)acetyl]-4-(trifluoromethoxy)benzohydrazide.
| Compound Name | N'-[2-(4-ethylphenoxy)acetyl]-4-(trifluoromethoxy)benzohydrazide |
|---|---|
| PubChem CID | 2090675 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N'-[2-(4-ethylphenoxy)acetyl]-4-(trifluoromethoxy)benzohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H17F3N2O4/c1-2-12-3-7-14(8-4-12)26-11-16(24)22-23-17(25)13-5-9-15(10-6-13)27-18(19,20)21/h3-10H,2,11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | JICLZBKTJCZRHY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|