C18H17N3O3 — CID 2571476
4-cyano-N'-[2-(4-ethylphenoxy)acetyl]benzohydrazide (PubChem CID 2571476) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-cyano-N'-[2-(4-ethylphenoxy)acetyl]benzohydrazide.
| Compound Name | 4-cyano-N'-[2-(4-ethylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 2571476 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-cyano-N'-[2-(4-ethylphenoxy)acetyl]benzohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-2-13-5-9-16(10-6-13)24-12-17(22)20-21-18(23)15-7-3-14(11-19)4-8-15/h3-10H,2,12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | OXDGQZVWVCVMRZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|