C21H23F3N2O6 — CID 43002106
3,4,5-triethoxy-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide (PubChem CID 43002106) has the molecular formula C21H23F3N2O6 and a molecular weight of 456.42 g/mol. Its IUPAC name is 3,4,5-triethoxy-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide.
| Compound Name | 3,4,5-triethoxy-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 43002106 |
| Molecular Formula | C21H23F3N2O6 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3,4,5-triethoxy-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(OC(F)(F)F)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H23F3N2O6/c1-4-29-16-11-14(12-17(30-5-2)18(16)31-6-3)20(28)26-25-19(27)13-7-9-15(10-8-13)32-21(22,23)24/h7-12H,4-6H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | QMSINACNCIXKTP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|