C23H30N2O5S — CID 55834203
3,4,5-triethoxy-N'-(4-propan-2-ylsulfanylbenzoyl)benzohydrazide (PubChem CID 55834203) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is 3,4,5-triethoxy-N'-(4-propan-2-ylsulfanylbenzoyl)benzohydrazide.
| Compound Name | 3,4,5-triethoxy-N'-(4-propan-2-ylsulfanylbenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 55834203 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 3,4,5-triethoxy-N'-(4-propan-2-ylsulfanylbenzoyl)benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(SC(C)C)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H30N2O5S/c1-6-28-19-13-17(14-20(29-7-2)21(19)30-8-3)23(27)25-24-22(26)16-9-11-18(12-10-16)31-15(4)5/h9-15H,6-8H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | JRDKHGTWECKKBK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|